C15H18N4O3 — CID 135672488
1,3-diethyl-6-hydroxy-5-[(4-methylphenyl)diazenyl]pyrimidine-2,4-dione (PubChem CID 135672488) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 1,3-diethyl-6-hydroxy-5-[(4-methylphenyl)diazenyl]pyrimidine-2,4-dione.
| Compound Name | 1,3-diethyl-6-hydroxy-5-[(4-methylphenyl)diazenyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135672488 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 1,3-diethyl-6-hydroxy-5-[(4-methylphenyl)diazenyl]pyrimidine-2,4-dione |
| SMILES | CCn1c(O)c(/N=N/c2ccc(C)cc2)c(=O)n(CC)c1=O |
| InChI | InChI=1S/C15H18N4O3/c1-4-18-13(20)12(14(21)19(5-2)15(18)22)17-16-11-8-6-10(3)7-9-11/h6-9,20H,4-5H2,1-3H3/b17-16+ |
| InChIKey | FZPJIRYCRXOSOX-WUKNDPDISA-N |
| XLogP | 2.48 |
| TPSA | 88.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|