C16H16N4O2 — CID 137199809
1,4-diethyl-2-hydroxy-6-oxo-5-phenyldiazenylpyridine-3-carbonitrile (PubChem CID 137199809) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is 1,4-diethyl-2-hydroxy-6-oxo-5-phenyldiazenylpyridine-3-carbonitrile.
| Compound Name | 1,4-diethyl-2-hydroxy-6-oxo-5-phenyldiazenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 137199809 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 1,4-diethyl-2-hydroxy-6-oxo-5-phenyldiazenylpyridine-3-carbonitrile |
| SMILES | CCc1c(C#N)c(O)n(CC)c(=O)c1/N=N/c1ccccc1 |
| InChI | InChI=1S/C16H16N4O2/c1-3-12-13(10-17)15(21)20(4-2)16(22)14(12)19-18-11-8-6-5-7-9-11/h5-9,21H,3-4H2,1-2H3/b19-18+ |
| InChIKey | BSNAPTCVXHRAHX-VHEBQXMUSA-N |
| XLogP | 3.42 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|