C24H18N4O3 — CID 135835287
1-(furan-2-ylmethyl)-2-hydroxy-4-methyl-6-oxo-5-[(4-phenylphenyl)diazenyl]pyridine-3-carbonitrile (PubChem CID 135835287) has the molecular formula C24H18N4O3 and a molecular weight of 410.43 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-2-hydroxy-4-methyl-6-oxo-5-[(4-phenylphenyl)diazenyl]pyridine-3-carbonitrile.
| Compound Name | 1-(furan-2-ylmethyl)-2-hydroxy-4-methyl-6-oxo-5-[(4-phenylphenyl)diazenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135835287 |
| Molecular Formula | C24H18N4O3 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 1-(furan-2-ylmethyl)-2-hydroxy-4-methyl-6-oxo-5-[(4-phenylphenyl)diazenyl]pyridine-3-carbonitrile |
| SMILES | Cc1c(C#N)c(O)n(Cc2ccco2)c(=O)c1/N=N/c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H18N4O3/c1-16-21(14-25)23(29)28(15-20-8-5-13-31-20)24(30)22(16)27-26-19-11-9-18(10-12-19)17-6-3-2-4-7-17/h2-13,29H,15H2,1H3/b27-26+ |
| InChIKey | GURBKALNBFSEEI-CYYJNZCTSA-N |
| XLogP | 5.46 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|