C24H21N4NaO6S2 — CID 135750084
sodium 6-amino-5-[[3-[(2-ethylphenyl)sulfamoyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonate (PubChem CID 135750084) has the molecular formula C24H21N4NaO6S2 and a molecular weight of 548.58 g/mol. Its IUPAC name is sodium 6-amino-5-[[3-[(2-ethylphenyl)sulfamoyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonate.
| Compound Name | sodium 6-amino-5-[[3-[(2-ethylphenyl)sulfamoyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 135750084 |
| Molecular Formula | C24H21N4NaO6S2 |
| Molecular Weight | 548.58 g/mol |
| Exact Mass | 548.08 |
| IUPAC Name | sodium 6-amino-5-[[3-[(2-ethylphenyl)sulfamoyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonate |
| SMILES | CCc1ccccc1NS(=O)(=O)c1cccc(/N=N/c2c(N)ccc3cc(S(=O)(=O)[O-])cc(O)c23)c1.[Na+] |
| InChI | InChI=1S/C24H22N4O6S2.Na/c1-2-15-6-3-4-9-21(15)28-35(30,31)18-8-5-7-17(13-18)26-27-24-20(25)11-10-16-12-19(36(32,33)34)14-22(29)23(16)24;/h3-14,28-29H,2,25H2,1H3,(H,32,33,34);/q;+1/p-1/b27-26+; |
| InChIKey | ROIIDZMSAUCGAZ-JGUILPGDSA-M |
| XLogP | 1.81 |
| TPSA | 174.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.58 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|