C30H24N5NaO7S2 — CID 135765401
sodium 5-[[2-[(4-acetamidophenyl)-phenylsulfamoyl]phenyl]diazenyl]-6-amino-4-hydroxynaphthalene-2-sulfonate (PubChem CID 135765401) has the molecular formula C30H24N5NaO7S2 and a molecular weight of 653.67 g/mol. Its IUPAC name is sodium 5-[[2-[(4-acetamidophenyl)-phenylsulfamoyl]phenyl]diazenyl]-6-amino-4-hydroxynaphthalene-2-sulfonate.
| Compound Name | sodium 5-[[2-[(4-acetamidophenyl)-phenylsulfamoyl]phenyl]diazenyl]-6-amino-4-hydroxynaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 135765401 |
| Molecular Formula | C30H24N5NaO7S2 |
| Molecular Weight | 653.67 g/mol |
| Exact Mass | 653.10 |
| IUPAC Name | sodium 5-[[2-[(4-acetamidophenyl)-phenylsulfamoyl]phenyl]diazenyl]-6-amino-4-hydroxynaphthalene-2-sulfonate |
| SMILES | CC(=O)Nc1ccc(N(c2ccccc2)S(=O)(=O)c2ccccc2/N=N/c2c(N)ccc3cc(S(=O)(=O)[O-])cc(O)c23)cc1.[Na+] |
| InChI | InChI=1S/C30H25N5O7S2.Na/c1-19(36)32-21-12-14-23(15-13-21)35(22-7-3-2-4-8-22)43(38,39)28-10-6-5-9-26(28)33-34-30-25(31)16-11-20-17-24(44(40,41)42)18-27(37)29(20)30;/h2-18,37H,31H2,1H3,(H,32,36)(H,40,41,42);/q;+1/p-1/b34-33+; |
| InChIKey | JXLKLEVWBDCHFA-GGTLNOMSSA-M |
| XLogP | 2.94 |
| TPSA | 194.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.67 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|