C23H20N4O6S2 — CID 161224538
methyl 6-amino-4-hydroxy-5-[[2-(phenylsulfamoyl)phenyl]diazenyl]naphthalene-2-sulfonate (PubChem CID 161224538) has the molecular formula C23H20N4O6S2 and a molecular weight of 512.57 g/mol. Its IUPAC name is methyl 6-amino-4-hydroxy-5-[[2-(phenylsulfamoyl)phenyl]diazenyl]naphthalene-2-sulfonate.
| Compound Name | methyl 6-amino-4-hydroxy-5-[[2-(phenylsulfamoyl)phenyl]diazenyl]naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 161224538 |
| Molecular Formula | C23H20N4O6S2 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | methyl 6-amino-4-hydroxy-5-[[2-(phenylsulfamoyl)phenyl]diazenyl]naphthalene-2-sulfonate |
| SMILES | COS(=O)(=O)c1cc(O)c2c(/N=N/c3ccccc3S(=O)(=O)Nc3ccccc3)c(N)ccc2c1 |
| InChI | InChI=1S/C23H20N4O6S2/c1-33-35(31,32)17-13-15-11-12-18(24)23(22(15)20(28)14-17)26-25-19-9-5-6-10-21(19)34(29,30)27-16-7-3-2-4-8-16/h2-14,27-28H,24H2,1H3/b26-25+ |
| InChIKey | ZDEHUJSQEYJTKX-OCEACIFDSA-N |
| XLogP | 4.68 |
| TPSA | 160.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|