C32H28ClN5O10S3 — CID 135570502
4-[[6-amino-5-[[2-[4-[(2-chloroacetyl)amino]phenoxy]sulfonylphenyl]diazenyl]-4-hydroxynaphthalen-2-yl]sulfonyl-ethylamino]benzenesulfonic acid (PubChem CID 135570502) has the molecular formula C32H28ClN5O10S3 and a molecular weight of 774.26 g/mol. Its IUPAC name is 4-[[6-amino-5-[[2-[4-[(2-chloroacetyl)amino]phenoxy]sulfonylphenyl]diazenyl]-4-hydroxynaphthalen-2-yl]sulfonyl-ethylamino]benzenesulfonic acid.
| Compound Name | 4-[[6-amino-5-[[2-[4-[(2-chloroacetyl)amino]phenoxy]sulfonylphenyl]diazenyl]-4-hydroxynaphthalen-2-yl]sulfonyl-ethylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 135570502 |
| Molecular Formula | C32H28ClN5O10S3 |
| Molecular Weight | 774.26 g/mol |
| Exact Mass | 773.07 |
| IUPAC Name | 4-[[6-amino-5-[[2-[4-[(2-chloroacetyl)amino]phenoxy]sulfonylphenyl]diazenyl]-4-hydroxynaphthalen-2-yl]sulfonyl-ethylamino]benzenesulfonic acid |
| SMILES | CCN(c1ccc(S(=O)(=O)O)cc1)S(=O)(=O)c1cc(O)c2c(/N=N/c3ccccc3S(=O)(=O)Oc3ccc(NC(=O)CCl)cc3)c(N)ccc2c1 |
| InChI | InChI=1S/C32H28ClN5O10S3/c1-2-38(22-10-14-24(15-11-22)50(43,44)45)49(41,42)25-17-20-7-16-26(34)32(31(20)28(39)18-25)37-36-27-5-3-4-6-29(27)51(46,47)48-23-12-8-21(9-13-23)35-30(40)19-33/h3-18,39H,2,19,34H2,1H3,(H,35,40)(H,43,44,45)/b37-36+ |
| InChIKey | OJMHLRYUUXUNOH-BSRQYYOTSA-N |
| XLogP | 5.95 |
| TPSA | 235.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.26 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|