C25H24N4O6S2 — CID 161224539
methyl 6-amino-5-[[2-[ethyl(phenyl)sulfamoyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonate (PubChem CID 161224539) has the molecular formula C25H24N4O6S2 and a molecular weight of 540.62 g/mol. Its IUPAC name is methyl 6-amino-5-[[2-[ethyl(phenyl)sulfamoyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonate.
| Compound Name | methyl 6-amino-5-[[2-[ethyl(phenyl)sulfamoyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 161224539 |
| Molecular Formula | C25H24N4O6S2 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | methyl 6-amino-5-[[2-[ethyl(phenyl)sulfamoyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonate |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccccc1/N=N/c1c(N)ccc2cc(S(=O)(=O)OC)cc(O)c12 |
| InChI | InChI=1S/C25H24N4O6S2/c1-3-29(18-9-5-4-6-10-18)36(31,32)23-12-8-7-11-21(23)27-28-25-20(26)14-13-17-15-19(37(33,34)35-2)16-22(30)24(17)25/h4-16,30H,3,26H2,1-2H3/b28-27+ |
| InChIKey | UJBIIQKVBXBYRI-BYYHNAKLSA-N |
| XLogP | 5.09 |
| TPSA | 151.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|