C33H30ClN5NaO11S4+ — CID 91844502
sodium 6-amino-5-[[4-[[3-(benzenesulfonyl)-3-chloropropanoyl]amino]-2-[ethyl(phenyl)sulfamoyl]phenyl]diazenyl]naphthalene-1,3-disulfonic acid (PubChem CID 91844502) has the molecular formula C33H30ClN5NaO11S4+ and a molecular weight of 859.34 g/mol. Its IUPAC name is sodium 6-amino-5-[[4-[[3-(benzenesulfonyl)-3-chloropropanoyl]amino]-2-[ethyl(phenyl)sulfamoyl]phenyl]diazenyl]naphthalene-1,3-disulfonic acid.
| Compound Name | sodium 6-amino-5-[[4-[[3-(benzenesulfonyl)-3-chloropropanoyl]amino]-2-[ethyl(phenyl)sulfamoyl]phenyl]diazenyl]naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 91844502 |
| Molecular Formula | C33H30ClN5NaO11S4+ |
| Molecular Weight | 859.34 g/mol |
| Exact Mass | 858.04 |
| IUPAC Name | sodium 6-amino-5-[[4-[[3-(benzenesulfonyl)-3-chloropropanoyl]amino]-2-[ethyl(phenyl)sulfamoyl]phenyl]diazenyl]naphthalene-1,3-disulfonic acid |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1cc(NC(=O)CC(Cl)S(=O)(=O)c2ccccc2)ccc1/N=N/c1c(N)ccc2c(S(=O)(=O)O)cc(S(=O)(=O)O)cc12.[Na+] |
| InChI | InChI=1S/C33H30ClN5O11S4.Na/c1-2-39(22-9-5-3-6-10-22)52(43,44)30-17-21(36-32(40)20-31(34)51(41,42)23-11-7-4-8-12-23)13-16-28(30)37-38-33-26-18-24(53(45,46)47)19-29(54(48,49)50)25(26)14-15-27(33)35;/h3-19,31H,2,20,35H2,1H3,(H,36,40)(H,45,46,47)(H,48,49,50);/q;+1/b38-37+; |
| InChIKey | QDUPWOZNUXERDK-SPWUYRNJSA-N |
| XLogP | 2.92 |
| TPSA | 260.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|