C15H15BrN2O6S2 — CID 88742251
2-amino-5-[[3-(benzenesulfonyl)-3-bromopropanoyl]amino]benzenesulfonic acid (PubChem CID 88742251) has the molecular formula C15H15BrN2O6S2 and a molecular weight of 463.33 g/mol. Its IUPAC name is 2-amino-5-[[3-(benzenesulfonyl)-3-bromopropanoyl]amino]benzenesulfonic acid.
| Compound Name | 2-amino-5-[[3-(benzenesulfonyl)-3-bromopropanoyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 88742251 |
| Molecular Formula | C15H15BrN2O6S2 |
| Molecular Weight | 463.33 g/mol |
| Exact Mass | 461.96 |
| IUPAC Name | 2-amino-5-[[3-(benzenesulfonyl)-3-bromopropanoyl]amino]benzenesulfonic acid |
| SMILES | Nc1ccc(NC(=O)CC(Br)S(=O)(=O)c2ccccc2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C15H15BrN2O6S2/c16-14(25(20,21)11-4-2-1-3-5-11)9-15(19)18-10-6-7-12(17)13(8-10)26(22,23)24/h1-8,14H,9,17H2,(H,18,19)(H,22,23,24) |
| InChIKey | AJNVVBBYWQTHCI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 143.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|