C17H13N2O4S- — CID 135984927
3-[(2-hydroxy-6-methylnaphthalen-1-yl)diazenyl]benzenesulfonate (PubChem CID 135984927) has the molecular formula C17H13N2O4S- and a molecular weight of 341.37 g/mol. Its IUPAC name is 3-[(2-hydroxy-6-methylnaphthalen-1-yl)diazenyl]benzenesulfonate.
| Compound Name | 3-[(2-hydroxy-6-methylnaphthalen-1-yl)diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 135984927 |
| Molecular Formula | C17H13N2O4S- |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 3-[(2-hydroxy-6-methylnaphthalen-1-yl)diazenyl]benzenesulfonate |
| SMILES | Cc1ccc2c(/N=N/c3cccc(S(=O)(=O)[O-])c3)c(O)ccc2c1 |
| InChI | InChI=1S/C17H14N2O4S/c1-11-5-7-15-12(9-11)6-8-16(20)17(15)19-18-13-3-2-4-14(10-13)24(21,22)23/h2-10,20H,1H3,(H,21,22,23)/p-1/b19-18+ |
| InChIKey | LSJXBECJXXZVEE-VHEBQXMUSA-M |
| XLogP | 4.17 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|