C18H21N3O13S4 — CID 135977878
5-amino-4-hydroxy-7-(trihydroxy-λ4-sulfanyl)-6-[[4-[2-(trihydroxy-λ4-sulfanyl)oxyethylsulfonyl]phenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 135977878) has the molecular formula C18H21N3O13S4 and a molecular weight of 615.64 g/mol. Its IUPAC name is 5-amino-4-hydroxy-7-(trihydroxy-λ4-sulfanyl)-6-[[4-[2-(trihydroxy-λ4-sulfanyl)oxyethylsulfonyl]phenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 5-amino-4-hydroxy-7-(trihydroxy-λ4-sulfanyl)-6-[[4-[2-(trihydroxy-λ4-sulfanyl)oxyethylsulfonyl]phenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135977878 |
| Molecular Formula | C18H21N3O13S4 |
| Molecular Weight | 615.64 g/mol |
| Exact Mass | 615.00 |
| IUPAC Name | 5-amino-4-hydroxy-7-(trihydroxy-λ4-sulfanyl)-6-[[4-[2-(trihydroxy-λ4-sulfanyl)oxyethylsulfonyl]phenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | Nc1c(/N=N/c2ccc(S(=O)(=O)CCOS(O)(O)O)cc2)c(S(O)(O)O)cc2cc(S(=O)(=O)O)cc(O)c12 |
| InChI | InChI=1S/C18H21N3O13S4/c19-17-16-10(7-13(9-14(16)22)36(25,26)27)8-15(37(28,29)30)18(17)21-20-11-1-3-12(4-2-11)35(23,24)6-5-34-38(31,32)33/h1-4,7-9,22,28-33H,5-6,19H2,(H,25,26,27)/b21-20+ |
| InChIKey | SRBUTULRVONUPU-QZQOTICOSA-N |
| XLogP | 4.30 |
| TPSA | 290.09 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.64 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|