C28H28N7O16S5+ — CID 21044210
1-[2-[4-[[2,4-diamino-5-sulfo-3-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]-3-sulfophenyl]sulfanylperoxyethyl]pyridin-1-ium-4-carboxylic acid (PubChem CID 21044210) has the molecular formula C28H28N7O16S5+ and a molecular weight of 878.90 g/mol. Its IUPAC name is 1-[2-[4-[[2,4-diamino-5-sulfo-3-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]-3-sulfophenyl]sulfanylperoxyethyl]pyridin-1-ium-4-carboxylic acid.
| Compound Name | 1-[2-[4-[[2,4-diamino-5-sulfo-3-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]-3-sulfophenyl]sulfanylperoxyethyl]pyridin-1-ium-4-carboxylic acid |
|---|---|
| PubChem CID | 21044210 |
| Molecular Formula | C28H28N7O16S5+ |
| Molecular Weight | 878.90 g/mol |
| Exact Mass | 878.02 |
| IUPAC Name | 1-[2-[4-[[2,4-diamino-5-sulfo-3-[[4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]-3-sulfophenyl]sulfanylperoxyethyl]pyridin-1-ium-4-carboxylic acid |
| SMILES | Nc1c(/N=N/c2ccc(SOOCC[n+]3ccc(C(=O)O)cc3)cc2S(=O)(=O)O)cc(S(=O)(=O)O)c(N)c1/N=N/c1ccc(S(=O)(=O)CCOS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C28H27N7O16S5/c29-25-22(33-32-21-6-3-19(15-23(21)54(40,41)42)52-51-49-12-11-35-9-7-17(8-10-35)28(36)37)16-24(55(43,44)45)26(30)27(25)34-31-18-1-4-20(5-2-18)53(38,39)14-13-50-56(46,47)48/h1-10,15-16H,11-14H2,(H7-,29,30,31,32,36,37,40,41,42,43,44,45,46,47,48)/p+1 |
| InChIKey | ODVMSKFLJUNASA-UHFFFAOYSA-O |
| XLogP | 3.41 |
| TPSA | 367.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.90 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|