About 2-methyl-5-[2-(trihydroxy-λ4-sulfanyl)oxyethylsulfonyl]benzenesulfonic acid
2-methyl-5-[2-(trihydroxy-λ4-sulfanyl)oxyethylsulfonyl]benzenesulfonic acid (PubChem CID 59089210) has the molecular formula C9H14O9S3
and a molecular weight of 362.40 g/mol. Its IUPAC name is 2-methyl-5-[2-(trihydroxy-λ4-sulfanyl)oxyethylsulfonyl]benzenesulfonic acid.
Molecular Properties
| Compound Name | 2-methyl-5-[2-(trihydroxy-λ4-sulfanyl)oxyethylsulfonyl]benzenesulfonic acid |
| PubChem CID | 59089210 |
| Molecular Formula | C9H14O9S3 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | 2-methyl-5-[2-(trihydroxy-λ4-sulfanyl)oxyethylsulfonyl]benzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)CCOS(O)(O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C9H14O9S3/c1-7-2-3-8(6-9(7)20(12,13)14)19(10,11)5-4-18-21(15,16)17/h2-3,6,15-17H,4-5H2,1H3,(H,12,13,14) |
| InChIKey | JUTQZLNKKDCMBJ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-[2-(trihydroxy-λ4-sulfanyl)oxyethylsulfonyl]benzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-[2-(trihydroxy-λ4-sulfanyl)oxyethylsulfonyl]benzenesulfonic acid?
The IUPAC name of 2-methyl-5-[2-(trihydroxy-λ4-sulfanyl)oxyethylsulfonyl]benzenesulfonic acid (CID 59089210) is 2-methyl-5-[2-(trihydroxy-λ4-sulfanyl)oxyethylsulfonyl]benzenesulfonic acid.
What is the SMILES notation for 2-methyl-5-[2-(trihydroxy-λ4-sulfanyl)oxyethylsulfonyl]benzenesulfonic acid?
The canonical SMILES for 2-methyl-5-[2-(trihydroxy-λ4-sulfanyl)oxyethylsulfonyl]benzenesulfonic acid is Cc1ccc(S(=O)(=O)CCOS(O)(O)O)cc1S(=O)(=O)O.
What is the InChIKey of 2-methyl-5-[2-(trihydroxy-λ4-sulfanyl)oxyethylsulfonyl]benzenesulfonic acid?
The InChIKey is JUTQZLNKKDCMBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O9S3/c1-7-2-3-8(6-9(7)20(12,13)14)19(10,11)5-4-18-21(15,16)17/h2-3,6,15-17H,4-5H2,1H3,(H,12,13,14).
What are the key properties of 2-methyl-5-[2-(trihydroxy-λ4-sulfanyl)oxyethylsulfonyl]benzenesulfonic acid?
2-methyl-5-[2-(trihydroxy-λ4-sulfanyl)oxyethylsulfonyl]benzenesulfonic acid has a molecular weight of 362.40 g/mol, XLogP of 1.17, 6 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-[2-(trihydroxy-λ4-sulfanyl)oxyethylsulfonyl]benzenesulfonic acid is sourced from PubChem (CID 59089210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).