C10H14NO11S4- — CID 132582554
1-[2-(sulfinatoamino)ethyl]-2-sulfo-4-(2-sulfooxyethylsulfonyl)benzene (PubChem CID 132582554) has the molecular formula C10H14NO11S4- and a molecular weight of 452.49 g/mol. Its IUPAC name is 1-[2-(sulfinatoamino)ethyl]-2-sulfo-4-(2-sulfooxyethylsulfonyl)benzene.
| Compound Name | 1-[2-(sulfinatoamino)ethyl]-2-sulfo-4-(2-sulfooxyethylsulfonyl)benzene |
|---|---|
| PubChem CID | 132582554 |
| Molecular Formula | C10H14NO11S4- |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 451.95 |
| IUPAC Name | 1-[2-(sulfinatoamino)ethyl]-2-sulfo-4-(2-sulfooxyethylsulfonyl)benzene |
| SMILES | O=S([O-])NCCc1ccc(S(=O)(=O)CCOS(=O)(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C10H15NO11S4/c12-23(13)11-4-3-8-1-2-9(7-10(8)25(16,17)18)24(14,15)6-5-22-26(19,20)21/h1-2,7,11H,3-6H2,(H,12,13)(H,16,17,18)(H,19,20,21)/p-1 |
| InChIKey | DFEGTXLGYSRYBC-UHFFFAOYSA-M |
| XLogP | -1.55 |
| TPSA | 204.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|