C8H11NO8S3 — CID 90023014
1-(sulfinoamino)-4-(2-sulfooxyethylsulfonyl)benzene (PubChem CID 90023014) has the molecular formula C8H11NO8S3 and a molecular weight of 345.38 g/mol. Its IUPAC name is 1-(sulfinoamino)-4-(2-sulfooxyethylsulfonyl)benzene.
| Compound Name | 1-(sulfinoamino)-4-(2-sulfooxyethylsulfonyl)benzene |
|---|---|
| PubChem CID | 90023014 |
| Molecular Formula | C8H11NO8S3 |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 344.96 |
| IUPAC Name | 1-(sulfinoamino)-4-(2-sulfooxyethylsulfonyl)benzene |
| SMILES | O=S(O)Nc1ccc(S(=O)(=O)CCOS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C8H11NO8S3/c10-18(11)9-7-1-3-8(4-2-7)19(12,13)6-5-17-20(14,15)16/h1-4,9H,5-6H2,(H,10,11)(H,14,15,16) |
| InChIKey | UKVHLEDHJGOUKJ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 147.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|