C22H22N4O14S4 — CID 165363230
2-[4-[(2E)-2-[(5E)-2,6-dioxo-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]hydrazinylidene]cyclohex-3-en-1-ylidene]hydrazinyl]phenyl]sulfonylethyl hydrogen sulfate (PubChem CID 165363230) has the molecular formula C22H22N4O14S4 and a molecular weight of 694.70 g/mol. Its IUPAC name is 2-[4-[(2E)-2-[(5E)-2,6-dioxo-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]hydrazinylidene]cyclohex-3-en-1-ylidene]hydrazinyl]phenyl]sulfonylethyl hydrogen sulfate.
| Compound Name | 2-[4-[(2E)-2-[(5E)-2,6-dioxo-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]hydrazinylidene]cyclohex-3-en-1-ylidene]hydrazinyl]phenyl]sulfonylethyl hydrogen sulfate |
|---|---|
| PubChem CID | 165363230 |
| Molecular Formula | C22H22N4O14S4 |
| Molecular Weight | 694.70 g/mol |
| Exact Mass | 694.00 |
| IUPAC Name | 2-[4-[(2E)-2-[(5E)-2,6-dioxo-5-[[4-(2-sulfooxyethylsulfonyl)phenyl]hydrazinylidene]cyclohex-3-en-1-ylidene]hydrazinyl]phenyl]sulfonylethyl hydrogen sulfate |
| SMILES | O=c1cc/c(=N\Nc2ccc(S(=O)(=O)CCOS(=O)(=O)O)cc2)c(=O)/c1=N/Nc1ccc(S(=O)(=O)CCOS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C22H22N4O14S4/c27-20-10-9-19(25-23-15-1-5-17(6-2-15)41(29,30)13-11-39-43(33,34)35)22(28)21(20)26-24-16-3-7-18(8-4-16)42(31,32)14-12-40-44(36,37)38/h1-10,23-24H,11-14H2,(H,33,34,35)(H,36,37,38)/b25-19+,26-21+ |
| InChIKey | XSBAZMCRSFGYGT-WPXMIFRISA-N |
| XLogP | -1.68 |
| TPSA | 278.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.70 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|