C18H13N5O8S — CID 57356284
4-hydroxy-3-[2-[5-[(4-nitrophenyl)hydrazinylidene]-4,6-dioxocyclohex-2-en-1-ylidene]hydrazinyl]benzenesulfonic acid (PubChem CID 57356284) has the molecular formula C18H13N5O8S and a molecular weight of 459.40 g/mol. Its IUPAC name is 4-hydroxy-3-[2-[5-[(4-nitrophenyl)hydrazinylidene]-4,6-dioxocyclohex-2-en-1-ylidene]hydrazinyl]benzenesulfonic acid.
| Compound Name | 4-hydroxy-3-[2-[5-[(4-nitrophenyl)hydrazinylidene]-4,6-dioxocyclohex-2-en-1-ylidene]hydrazinyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 57356284 |
| Molecular Formula | C18H13N5O8S |
| Molecular Weight | 459.40 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | 4-hydroxy-3-[2-[5-[(4-nitrophenyl)hydrazinylidene]-4,6-dioxocyclohex-2-en-1-ylidene]hydrazinyl]benzenesulfonic acid |
| SMILES | O=c1ccc(=NNc2cc(S(=O)(=O)O)ccc2O)c(=O)c1=NNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H13N5O8S/c24-15-7-5-12(32(29,30)31)9-14(15)21-20-13-6-8-16(25)17(18(13)26)22-19-10-1-3-11(4-2-10)23(27)28/h1-9,19,21,24H,(H,29,30,31) |
| InChIKey | HIMVSGRVYOIKFT-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 200.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.40 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|