C18H11CuN6NaO10S+2 — CID 172938624
copper;sodium;2-[(2Z)-2-[(5Z)-2,6-dioxo-5-[(4-sulfophenyl)hydrazinylidene]cyclohex-3-en-1-ylidene]hydrazinyl]-4,6-dinitrophenolate (PubChem CID 172938624) has the molecular formula C18H11CuN6NaO10S+2 and a molecular weight of 589.92 g/mol. Its IUPAC name is copper;sodium;2-[(2Z)-2-[(5Z)-2,6-dioxo-5-[(4-sulfophenyl)hydrazinylidene]cyclohex-3-en-1-ylidene]hydrazinyl]-4,6-dinitrophenolate.
| Compound Name | copper;sodium;2-[(2Z)-2-[(5Z)-2,6-dioxo-5-[(4-sulfophenyl)hydrazinylidene]cyclohex-3-en-1-ylidene]hydrazinyl]-4,6-dinitrophenolate |
|---|---|
| PubChem CID | 172938624 |
| Molecular Formula | C18H11CuN6NaO10S+2 |
| Molecular Weight | 589.92 g/mol |
| Exact Mass | 588.94 |
| IUPAC Name | copper;sodium;2-[(2Z)-2-[(5Z)-2,6-dioxo-5-[(4-sulfophenyl)hydrazinylidene]cyclohex-3-en-1-ylidene]hydrazinyl]-4,6-dinitrophenolate |
| SMILES | O=c1cc/c(=N/Nc2ccc(S(=O)(=O)O)cc2)c(=O)/c1=N\Nc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1[O-].[Cu+2].[Na+] |
| InChI | InChI=1S/C18H12N6O10S.Cu.Na/c25-15-6-5-12(20-19-9-1-3-11(4-2-9)35(32,33)34)18(27)16(15)22-21-13-7-10(23(28)29)8-14(17(13)26)24(30)31;;/h1-8,19,21,26H,(H,32,33,34);;/q;+2;+1/p-1/b20-12-,22-16-;; |
| InChIKey | VNMQKIZPHDIHGL-XLAAJKAOSA-M |
| XLogP | -3.72 |
| TPSA | 246.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.92 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|