C22H14N6O10S — CID 58810932
5-[(2E)-2-[(5E)-5-[(2-hydroxy-3,5-dinitrophenyl)hydrazinylidene]-2,6-dioxocyclohex-3-en-1-ylidene]hydrazinyl]naphthalene-2-sulfonic acid (PubChem CID 58810932) has the molecular formula C22H14N6O10S and a molecular weight of 554.45 g/mol. Its IUPAC name is 5-[(2E)-2-[(5E)-5-[(2-hydroxy-3,5-dinitrophenyl)hydrazinylidene]-2,6-dioxocyclohex-3-en-1-ylidene]hydrazinyl]naphthalene-2-sulfonic acid.
| Compound Name | 5-[(2E)-2-[(5E)-5-[(2-hydroxy-3,5-dinitrophenyl)hydrazinylidene]-2,6-dioxocyclohex-3-en-1-ylidene]hydrazinyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 58810932 |
| Molecular Formula | C22H14N6O10S |
| Molecular Weight | 554.45 g/mol |
| Exact Mass | 554.05 |
| IUPAC Name | 5-[(2E)-2-[(5E)-5-[(2-hydroxy-3,5-dinitrophenyl)hydrazinylidene]-2,6-dioxocyclohex-3-en-1-ylidene]hydrazinyl]naphthalene-2-sulfonic acid |
| SMILES | O=c1cc/c(=N\Nc2cc([N+](=O)[O-])cc([N+](=O)[O-])c2O)c(=O)/c1=N/Nc1cccc2cc(S(=O)(=O)O)ccc12 |
| InChI | InChI=1S/C22H14N6O10S/c29-19-7-6-16(24-25-17-9-12(27(32)33)10-18(21(17)30)28(34)35)22(31)20(19)26-23-15-3-1-2-11-8-13(39(36,37)38)4-5-14(11)15/h1-10,23,25,30H,(H,36,37,38)/b24-16+,26-20+ |
| InChIKey | BAWKLPAQKWUQGC-NTLMQBHESA-N |
| XLogP | 1.06 |
| TPSA | 243.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.45 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|