C23H16N4O7S — CID 73170005
2-[2-[4,6-dioxo-5-[(5-sulfonaphthalen-1-yl)hydrazinylidene]cyclohex-2-en-1-ylidene]hydrazinyl]benzoic acid (PubChem CID 73170005) has the molecular formula C23H16N4O7S and a molecular weight of 492.47 g/mol. Its IUPAC name is 2-[2-[4,6-dioxo-5-[(5-sulfonaphthalen-1-yl)hydrazinylidene]cyclohex-2-en-1-ylidene]hydrazinyl]benzoic acid.
| Compound Name | 2-[2-[4,6-dioxo-5-[(5-sulfonaphthalen-1-yl)hydrazinylidene]cyclohex-2-en-1-ylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 73170005 |
| Molecular Formula | C23H16N4O7S |
| Molecular Weight | 492.47 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | 2-[2-[4,6-dioxo-5-[(5-sulfonaphthalen-1-yl)hydrazinylidene]cyclohex-2-en-1-ylidene]hydrazinyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1NN=c1ccc(=O)c(=NNc2cccc3c(S(=O)(=O)O)cccc23)c1=O |
| InChI | InChI=1S/C23H16N4O7S/c28-19-12-11-18(26-24-17-8-2-1-5-15(17)23(30)31)22(29)21(19)27-25-16-9-3-7-14-13(16)6-4-10-20(14)35(32,33)34/h1-12,24-25H,(H,30,31)(H,32,33,34) |
| InChIKey | BPAQVWCYACJIDT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 174.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.47 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_acid_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|