C19H14N4O7S — CID 20832866
2-[(2Z)-2-[(5E)-2,6-dioxo-5-[(3-sulfophenyl)hydrazinylidene]cyclohex-3-en-1-ylidene]hydrazinyl]benzoic acid (PubChem CID 20832866) has the molecular formula C19H14N4O7S and a molecular weight of 442.41 g/mol. Its IUPAC name is 2-[(2Z)-2-[(5E)-2,6-dioxo-5-[(3-sulfophenyl)hydrazinylidene]cyclohex-3-en-1-ylidene]hydrazinyl]benzoic acid.
| Compound Name | 2-[(2Z)-2-[(5E)-2,6-dioxo-5-[(3-sulfophenyl)hydrazinylidene]cyclohex-3-en-1-ylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 20832866 |
| Molecular Formula | C19H14N4O7S |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 2-[(2Z)-2-[(5E)-2,6-dioxo-5-[(3-sulfophenyl)hydrazinylidene]cyclohex-3-en-1-ylidene]hydrazinyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1N/N=c1/c(=O)cc/c(=N\Nc2cccc(S(=O)(=O)O)c2)c1=O |
| InChI | InChI=1S/C19H14N4O7S/c24-16-9-8-15(22-20-11-4-3-5-12(10-11)31(28,29)30)18(25)17(16)23-21-14-7-2-1-6-13(14)19(26)27/h1-10,20-21H,(H,26,27)(H,28,29,30)/b22-15+,23-17- |
| InChIKey | CPVSPAVSUVTIDU-LTQVYNCTSA-N |
| XLogP | 0.08 |
| TPSA | 174.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_acid_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|