C26H18N4O8S2 — CID 138395874
4-[(2Z)-2-[(5Z)-2,6-dioxo-5-[(7-sulfonaphthalen-1-yl)hydrazinylidene]cyclohex-3-en-1-ylidene]hydrazinyl]naphthalene-1-sulfonic acid (PubChem CID 138395874) has the molecular formula C26H18N4O8S2 and a molecular weight of 578.58 g/mol. Its IUPAC name is 4-[(2Z)-2-[(5Z)-2,6-dioxo-5-[(7-sulfonaphthalen-1-yl)hydrazinylidene]cyclohex-3-en-1-ylidene]hydrazinyl]naphthalene-1-sulfonic acid.
| Compound Name | 4-[(2Z)-2-[(5Z)-2,6-dioxo-5-[(7-sulfonaphthalen-1-yl)hydrazinylidene]cyclohex-3-en-1-ylidene]hydrazinyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 138395874 |
| Molecular Formula | C26H18N4O8S2 |
| Molecular Weight | 578.58 g/mol |
| Exact Mass | 578.06 |
| IUPAC Name | 4-[(2Z)-2-[(5Z)-2,6-dioxo-5-[(7-sulfonaphthalen-1-yl)hydrazinylidene]cyclohex-3-en-1-ylidene]hydrazinyl]naphthalene-1-sulfonic acid |
| SMILES | O=c1cc/c(=N/Nc2cccc3ccc(S(=O)(=O)O)cc23)c(=O)/c1=N\Nc1ccc(S(=O)(=O)O)c2ccccc12 |
| InChI | InChI=1S/C26H18N4O8S2/c31-23-12-10-22(29-27-20-7-3-4-15-8-9-16(14-19(15)20)39(33,34)35)26(32)25(23)30-28-21-11-13-24(40(36,37)38)18-6-2-1-5-17(18)21/h1-14,27-28H,(H,33,34,35)(H,36,37,38)/b29-22-,30-25- |
| InChIKey | HLMNXSYQCUHIBI-FUNKXNGNSA-N |
| XLogP | 1.94 |
| TPSA | 191.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.58 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|