C27H20N4Na2O9S2 — CID 170839406
CID 170839406 (PubChem CID 170839406) has the molecular formula C27H20N4Na2O9S2 and a molecular weight of 654.59 g/mol.
| Compound Name | CID 170839406 |
|---|---|
| PubChem CID | 170839406 |
| Molecular Formula | C27H20N4Na2O9S2 |
| Molecular Weight | 654.59 g/mol |
| Exact Mass | 654.05 |
| IUPAC Name | — |
| SMILES | O=c1c(CO)cc(=NNc2ccc(S(=O)(=O)O)c3ccccc23)c(=O)c1=NNc1ccc(S(=O)(=O)O)c2ccccc12.[Na].[Na] |
| InChI | InChI=1S/C27H20N4O9S2.2Na/c32-14-15-13-22(30-28-20-9-11-23(41(35,36)37)18-7-3-1-5-16(18)20)27(34)25(26(15)33)31-29-21-10-12-24(42(38,39)40)19-8-4-2-6-17(19)21;;/h1-13,28-29,32H,14H2,(H,35,36,37)(H,38,39,40);; |
| InChIKey | TVHIILUEYTWEBF-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 211.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.59 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|