C26H18N4NaO8S2+ — CID 54598716
sodium 4-[(2Z)-2-[(5Z)-4,6-dioxo-5-[(4-sulfonaphthalen-1-yl)hydrazinylidene]cyclohex-2-en-1-ylidene]hydrazinyl]naphthalene-1-sulfonic acid (PubChem CID 54598716) has the molecular formula C26H18N4NaO8S2+ and a molecular weight of 601.57 g/mol. Its IUPAC name is sodium 4-[(2Z)-2-[(5Z)-4,6-dioxo-5-[(4-sulfonaphthalen-1-yl)hydrazinylidene]cyclohex-2-en-1-ylidene]hydrazinyl]naphthalene-1-sulfonic acid.
| Compound Name | sodium 4-[(2Z)-2-[(5Z)-4,6-dioxo-5-[(4-sulfonaphthalen-1-yl)hydrazinylidene]cyclohex-2-en-1-ylidene]hydrazinyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 54598716 |
| Molecular Formula | C26H18N4NaO8S2+ |
| Molecular Weight | 601.57 g/mol |
| Exact Mass | 601.05 |
| IUPAC Name | sodium 4-[(2Z)-2-[(5Z)-4,6-dioxo-5-[(4-sulfonaphthalen-1-yl)hydrazinylidene]cyclohex-2-en-1-ylidene]hydrazinyl]naphthalene-1-sulfonic acid |
| SMILES | O=c1cc/c(=N/Nc2ccc(S(=O)(=O)O)c3ccccc23)c(=O)/c1=N\Nc1ccc(S(=O)(=O)O)c2ccccc12.[Na+] |
| InChI | InChI=1S/C26H18N4O8S2.Na/c31-22-12-9-21(29-27-19-10-13-23(39(33,34)35)17-7-3-1-5-15(17)19)26(32)25(22)30-28-20-11-14-24(40(36,37)38)18-8-4-2-6-16(18)20;/h1-14,27-28H,(H,33,34,35)(H,36,37,38);/q;+1/b29-21-,30-25-; |
| InChIKey | CHLYOJHWAVDAMR-QPCNSSIFSA-N |
| XLogP | -1.06 |
| TPSA | 191.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.57 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|