C28H26N6O21S6 — CID 173498219
2-[[2-hydroxy-4,6-dioxo-3,5-bis[[4-(2-sulfooxyethylsulfonyl)phenyl]hydrazinylidene]cyclohexen-1-yl]diazenyl]benzene-1,4-disulfonic acid (PubChem CID 173498219) has the molecular formula C28H26N6O21S6 and a molecular weight of 974.94 g/mol. Its IUPAC name is 2-[[2-hydroxy-4,6-dioxo-3,5-bis[[4-(2-sulfooxyethylsulfonyl)phenyl]hydrazinylidene]cyclohexen-1-yl]diazenyl]benzene-1,4-disulfonic acid.
| Compound Name | 2-[[2-hydroxy-4,6-dioxo-3,5-bis[[4-(2-sulfooxyethylsulfonyl)phenyl]hydrazinylidene]cyclohexen-1-yl]diazenyl]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 173498219 |
| Molecular Formula | C28H26N6O21S6 |
| Molecular Weight | 974.94 g/mol |
| Exact Mass | 973.95 |
| IUPAC Name | 2-[[2-hydroxy-4,6-dioxo-3,5-bis[[4-(2-sulfooxyethylsulfonyl)phenyl]hydrazinylidene]cyclohexen-1-yl]diazenyl]benzene-1,4-disulfonic acid |
| SMILES | O=c1c(/N=N/c2cc(S(=O)(=O)O)ccc2S(=O)(=O)O)c(O)c(=NNc2ccc(S(=O)(=O)CCOS(=O)(=O)O)cc2)c(=O)c1=NNc1ccc(S(=O)(=O)CCOS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C28H26N6O21S6/c35-26-23(32-29-16-1-5-18(6-2-16)56(38,39)13-11-54-60(48,49)50)27(36)25(34-31-21-15-20(58(42,43)44)9-10-22(21)59(45,46)47)28(37)24(26)33-30-17-3-7-19(8-4-17)57(40,41)14-12-55-61(51,52)53/h1-10,15,29-30,36H,11-14H2,(H,42,43,44)(H,45,46,47)(H,48,49,50)(H,51,52,53)/b32-23?,33-24?,34-31+ |
| InChIKey | BZJZINHKADRJJH-NFQADCBVSA-N |
| XLogP | -1.06 |
| TPSA | 432.09 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 23 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 974.94 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 23 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|