C23H20N4O15S4 — CID 157315430
3,5-dioxo-6-[[4-(1-sulfinoethenyl)phenyl]hydrazinylidene]-4-[[2-sulfo-4-(2-sulfooxyethylsulfonyl)phenyl]hydrazinylidene]cyclohexene-1-carboxylic acid (PubChem CID 157315430) has the molecular formula C23H20N4O15S4 and a molecular weight of 720.69 g/mol. Its IUPAC name is 3,5-dioxo-6-[[4-(1-sulfinoethenyl)phenyl]hydrazinylidene]-4-[[2-sulfo-4-(2-sulfooxyethylsulfonyl)phenyl]hydrazinylidene]cyclohexene-1-carboxylic acid.
| Compound Name | 3,5-dioxo-6-[[4-(1-sulfinoethenyl)phenyl]hydrazinylidene]-4-[[2-sulfo-4-(2-sulfooxyethylsulfonyl)phenyl]hydrazinylidene]cyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 157315430 |
| Molecular Formula | C23H20N4O15S4 |
| Molecular Weight | 720.69 g/mol |
| Exact Mass | 719.98 |
| IUPAC Name | 3,5-dioxo-6-[[4-(1-sulfinoethenyl)phenyl]hydrazinylidene]-4-[[2-sulfo-4-(2-sulfooxyethylsulfonyl)phenyl]hydrazinylidene]cyclohexene-1-carboxylic acid |
| SMILES | C=C(c1ccc(NN=c2c(C(=O)O)cc(=O)c(=NNc3ccc(S(=O)(=O)CCOS(=O)(=O)O)cc3S(=O)(=O)O)c2=O)cc1)S(=O)O |
| InChI | InChI=1S/C23H20N4O15S4/c1-12(43(32)33)13-2-4-14(5-3-13)24-26-20-16(23(30)31)11-18(28)21(22(20)29)27-25-17-7-6-15(10-19(17)45(36,37)38)44(34,35)9-8-42-46(39,40)41/h2-7,10-11,24-25H,1,8-9H2,(H,30,31)(H,32,33)(H,36,37,38)(H,39,40,41) |
| InChIKey | HGBBGQNOULQCJI-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 309.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.69 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|