C25H22N4O10S2 — CID 155608049
(4E,6Z)-4-[(4-ethenylsulfonyl-2-methoxyphenyl)hydrazinylidene]-6-[[2-methoxy-4-(1-sulfinoethenyl)phenyl]hydrazinylidene]-3,5-dioxocyclohexene-1-carboxylic acid (PubChem CID 155608049) has the molecular formula C25H22N4O10S2 and a molecular weight of 602.60 g/mol. Its IUPAC name is (4E,6Z)-4-[(4-ethenylsulfonyl-2-methoxyphenyl)hydrazinylidene]-6-[[2-methoxy-4-(1-sulfinoethenyl)phenyl]hydrazinylidene]-3,5-dioxocyclohexene-1-carboxylic acid.
| Compound Name | (4E,6Z)-4-[(4-ethenylsulfonyl-2-methoxyphenyl)hydrazinylidene]-6-[[2-methoxy-4-(1-sulfinoethenyl)phenyl]hydrazinylidene]-3,5-dioxocyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 155608049 |
| Molecular Formula | C25H22N4O10S2 |
| Molecular Weight | 602.60 g/mol |
| Exact Mass | 602.08 |
| IUPAC Name | (4E,6Z)-4-[(4-ethenylsulfonyl-2-methoxyphenyl)hydrazinylidene]-6-[[2-methoxy-4-(1-sulfinoethenyl)phenyl]hydrazinylidene]-3,5-dioxocyclohexene-1-carboxylic acid |
| SMILES | C=CS(=O)(=O)c1ccc(N/N=c2\c(=O)cc(C(=O)O)/c(=N/Nc3ccc(C(=C)S(=O)O)cc3OC)c2=O)c(OC)c1 |
| InChI | InChI=1S/C25H22N4O10S2/c1-5-41(36,37)15-7-9-18(21(11-15)39-4)27-29-23-19(30)12-16(25(32)33)22(24(23)31)28-26-17-8-6-14(10-20(17)38-3)13(2)40(34)35/h5-12,26-27H,1-2H2,3-4H3,(H,32,33)(H,34,35)/b28-22-,29-23+ |
| InChIKey | CLLGRNMRGXTUDU-XWFWGDPBSA-N |
| XLogP | 0.96 |
| TPSA | 210.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.60 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|