C16H20N4O3 — CID 86814263
4-[(2E)-2-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methylidene]hydrazinyl]-3-methoxybenzoic acid (PubChem CID 86814263) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is 4-[(2E)-2-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methylidene]hydrazinyl]-3-methoxybenzoic acid.
| Compound Name | 4-[(2E)-2-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methylidene]hydrazinyl]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 86814263 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 4-[(2E)-2-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methylidene]hydrazinyl]-3-methoxybenzoic acid |
| SMILES | CCn1nc(C)c(/C=N/Nc2ccc(C(=O)O)cc2OC)c1C |
| InChI | InChI=1S/C16H20N4O3/c1-5-20-11(3)13(10(2)19-20)9-17-18-14-7-6-12(16(21)22)8-15(14)23-4/h6-9,18H,5H2,1-4H3,(H,21,22)/b17-9+ |
| InChIKey | YJHZTPGRSCNFND-RQZCQDPDSA-N |
| XLogP | 2.67 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|