C16H21N3O7S — CID 154911750
3-[2-(4,5-dimethylimidazol-1-yl)ethylsulfamoyl]-4-methoxybenzoic acid;formic acid (PubChem CID 154911750) has the molecular formula C16H21N3O7S and a molecular weight of 399.43 g/mol. Its IUPAC name is 3-[2-(4,5-dimethylimidazol-1-yl)ethylsulfamoyl]-4-methoxybenzoic acid;formic acid.
| Compound Name | 3-[2-(4,5-dimethylimidazol-1-yl)ethylsulfamoyl]-4-methoxybenzoic acid;formic acid |
|---|---|
| PubChem CID | 154911750 |
| Molecular Formula | C16H21N3O7S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 3-[2-(4,5-dimethylimidazol-1-yl)ethylsulfamoyl]-4-methoxybenzoic acid;formic acid |
| SMILES | COc1ccc(C(=O)O)cc1S(=O)(=O)NCCn1cnc(C)c1C.O=CO |
| InChI | InChI=1S/C15H19N3O5S.CH2O2/c1-10-11(2)18(9-16-10)7-6-17-24(21,22)14-8-12(15(19)20)4-5-13(14)23-3;2-1-3/h4-5,8-9,17H,6-7H2,1-3H3,(H,19,20);1H,(H,2,3) |
| InChIKey | MRDSABOTZVBAQD-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|