C13H14N2O5S — CID 82858201
4-methoxy-3-[(1-methylpyrazol-3-yl)methylsulfonyl]benzoic acid (PubChem CID 82858201) has the molecular formula C13H14N2O5S and a molecular weight of 310.33 g/mol. Its IUPAC name is 4-methoxy-3-[(1-methylpyrazol-3-yl)methylsulfonyl]benzoic acid.
| Compound Name | 4-methoxy-3-[(1-methylpyrazol-3-yl)methylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 82858201 |
| Molecular Formula | C13H14N2O5S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 4-methoxy-3-[(1-methylpyrazol-3-yl)methylsulfonyl]benzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1S(=O)(=O)Cc1ccn(C)n1 |
| InChI | InChI=1S/C13H14N2O5S/c1-15-6-5-10(14-15)8-21(18,19)12-7-9(13(16)17)3-4-11(12)20-2/h3-7H,8H2,1-2H3,(H,16,17) |
| InChIKey | SQORYJSJIGZYTR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |