C14H20O6S — CID 103034367
4-methoxy-3-(3-methoxy-3-methylbutyl)sulfonylbenzoic acid (PubChem CID 103034367) has the molecular formula C14H20O6S and a molecular weight of 316.38 g/mol. Its IUPAC name is 4-methoxy-3-(3-methoxy-3-methylbutyl)sulfonylbenzoic acid.
| Compound Name | 4-methoxy-3-(3-methoxy-3-methylbutyl)sulfonylbenzoic acid |
|---|---|
| PubChem CID | 103034367 |
| Molecular Formula | C14H20O6S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 4-methoxy-3-(3-methoxy-3-methylbutyl)sulfonylbenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1S(=O)(=O)CCC(C)(C)OC |
| InChI | InChI=1S/C14H20O6S/c1-14(2,20-4)7-8-21(17,18)12-9-10(13(15)16)5-6-11(12)19-3/h5-6,9H,7-8H2,1-4H3,(H,15,16) |
| InChIKey | GWCSUVYPRRARIW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |