C17H16N4O11S3 — CID 136633055
4-[4-[[2-hydroxy-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-3-oxo-1H-pyrazol-2-yl]benzenesulfonic acid (PubChem CID 136633055) has the molecular formula C17H16N4O11S3 and a molecular weight of 548.53 g/mol. Its IUPAC name is 4-[4-[[2-hydroxy-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-3-oxo-1H-pyrazol-2-yl]benzenesulfonic acid.
| Compound Name | 4-[4-[[2-hydroxy-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-3-oxo-1H-pyrazol-2-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 136633055 |
| Molecular Formula | C17H16N4O11S3 |
| Molecular Weight | 548.53 g/mol |
| Exact Mass | 548.00 |
| IUPAC Name | 4-[4-[[2-hydroxy-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-3-oxo-1H-pyrazol-2-yl]benzenesulfonic acid |
| SMILES | O=c1c(/N=N/c2ccc(S(=O)(=O)CCOS(=O)(=O)O)cc2O)c[nH]n1-c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C17H16N4O11S3/c22-16-9-13(33(24,25)8-7-32-35(29,30)31)5-6-14(16)19-20-15-10-18-21(17(15)23)11-1-3-12(4-2-11)34(26,27)28/h1-6,9-10,18,22H,7-8H2,(H,26,27,28)(H,29,30,31)/b20-19+ |
| InChIKey | MOIITUHSGJGRFA-FMQUCBEESA-N |
| XLogP | 1.13 |
| TPSA | 234.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.53 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|