C19H18CuN2O13S4 — CID 135974224
copper;8-hydroxy-7-[(2-hydroxy-5-propylsulfonylphenyl)diazenyl]naphthalene-1,3,6-trisulfonic acid (PubChem CID 135974224) has the molecular formula C19H18CuN2O13S4 and a molecular weight of 674.17 g/mol. Its IUPAC name is copper;8-hydroxy-7-[(2-hydroxy-5-propylsulfonylphenyl)diazenyl]naphthalene-1,3,6-trisulfonic acid.
| Compound Name | copper;8-hydroxy-7-[(2-hydroxy-5-propylsulfonylphenyl)diazenyl]naphthalene-1,3,6-trisulfonic acid |
|---|---|
| PubChem CID | 135974224 |
| Molecular Formula | C19H18CuN2O13S4 |
| Molecular Weight | 674.17 g/mol |
| Exact Mass | 672.90 |
| IUPAC Name | copper;8-hydroxy-7-[(2-hydroxy-5-propylsulfonylphenyl)diazenyl]naphthalene-1,3,6-trisulfonic acid |
| SMILES | CCCS(=O)(=O)c1ccc(O)c(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c3c2O)c1.[Cu] |
| InChI | InChI=1S/C19H18N2O13S4.Cu/c1-2-5-35(24,25)11-3-4-14(22)13(8-11)20-21-18-16(38(32,33)34)7-10-6-12(36(26,27)28)9-15(37(29,30)31)17(10)19(18)23;/h3-4,6-9,22-23H,2,5H2,1H3,(H,26,27,28)(H,29,30,31)(H,32,33,34);/b21-20+; |
| InChIKey | QGGAMRFAAGUDCO-ANVLNOONSA-N |
| XLogP | 2.59 |
| TPSA | 262.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.17 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|