C18H16N2O12S4 — CID 136607030
7-[(5-ethylsulfonyl-2-hydroxyphenyl)diazenyl]-8-hydroxy-6-sulfinonaphthalene-1,3-disulfonic acid (PubChem CID 136607030) has the molecular formula C18H16N2O12S4 and a molecular weight of 580.60 g/mol. Its IUPAC name is 7-[(5-ethylsulfonyl-2-hydroxyphenyl)diazenyl]-8-hydroxy-6-sulfinonaphthalene-1,3-disulfonic acid.
| Compound Name | 7-[(5-ethylsulfonyl-2-hydroxyphenyl)diazenyl]-8-hydroxy-6-sulfinonaphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 136607030 |
| Molecular Formula | C18H16N2O12S4 |
| Molecular Weight | 580.60 g/mol |
| Exact Mass | 579.96 |
| IUPAC Name | 7-[(5-ethylsulfonyl-2-hydroxyphenyl)diazenyl]-8-hydroxy-6-sulfinonaphthalene-1,3-disulfonic acid |
| SMILES | CCS(=O)(=O)c1ccc(O)c(/N=N/c2c(S(=O)O)cc3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c3c2O)c1 |
| InChI | InChI=1S/C18H16N2O12S4/c1-2-34(25,26)10-3-4-13(21)12(7-10)19-20-17-14(33(23)24)6-9-5-11(35(27,28)29)8-15(36(30,31)32)16(9)18(17)22/h3-8,21-22H,2H2,1H3,(H,23,24)(H,27,28,29)(H,30,31,32)/b20-19+ |
| InChIKey | XATFHJZIPZXEDW-FMQUCBEESA-N |
| XLogP | 2.53 |
| TPSA | 245.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.60 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|