C19H17N3O6S — CID 3022818
[7-hydroxy-8-[(2-hydroxy-5-methylsulfonylphenyl)diazenyl]naphthalen-1-yl] N-methylcarbamate (PubChem CID 3022818) has the molecular formula C19H17N3O6S and a molecular weight of 415.43 g/mol. Its IUPAC name is [7-hydroxy-8-[(2-hydroxy-5-methylsulfonylphenyl)diazenyl]naphthalen-1-yl] N-methylcarbamate.
| Compound Name | [7-hydroxy-8-[(2-hydroxy-5-methylsulfonylphenyl)diazenyl]naphthalen-1-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 3022818 |
| Molecular Formula | C19H17N3O6S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | [7-hydroxy-8-[(2-hydroxy-5-methylsulfonylphenyl)diazenyl]naphthalen-1-yl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1cccc2ccc(O)c(/N=N/c3cc(S(C)(=O)=O)ccc3O)c12 |
| InChI | InChI=1S/C19H17N3O6S/c1-20-19(25)28-16-5-3-4-11-6-8-15(24)18(17(11)16)22-21-13-10-12(29(2,26)27)7-9-14(13)23/h3-10,23-24H,1-2H3,(H,20,25)/b22-21+ |
| InChIKey | CNJZRBJYXRCKIM-QURGRASLSA-N |
| XLogP | 3.79 |
| TPSA | 137.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|