C26H24N6O6S2 — CID 136954758
2,4-diamino-3-[(2-benzylphenyl)diazenyl]-5-[(2-hydroxy-5-methylsulfonylphenyl)diazenyl]benzenesulfonic acid (PubChem CID 136954758) has the molecular formula C26H24N6O6S2 and a molecular weight of 580.65 g/mol. Its IUPAC name is 2,4-diamino-3-[(2-benzylphenyl)diazenyl]-5-[(2-hydroxy-5-methylsulfonylphenyl)diazenyl]benzenesulfonic acid.
| Compound Name | 2,4-diamino-3-[(2-benzylphenyl)diazenyl]-5-[(2-hydroxy-5-methylsulfonylphenyl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 136954758 |
| Molecular Formula | C26H24N6O6S2 |
| Molecular Weight | 580.65 g/mol |
| Exact Mass | 580.12 |
| IUPAC Name | 2,4-diamino-3-[(2-benzylphenyl)diazenyl]-5-[(2-hydroxy-5-methylsulfonylphenyl)diazenyl]benzenesulfonic acid |
| SMILES | CS(=O)(=O)c1ccc(O)c(/N=N/c2cc(S(=O)(=O)O)c(N)c(/N=N/c3ccccc3Cc3ccccc3)c2N)c1 |
| InChI | InChI=1S/C26H24N6O6S2/c1-39(34,35)18-11-12-22(33)20(14-18)30-31-21-15-23(40(36,37)38)25(28)26(24(21)27)32-29-19-10-6-5-9-17(19)13-16-7-3-2-4-8-16/h2-12,14-15,33H,13,27-28H2,1H3,(H,36,37,38)/b31-30+,32-29+ |
| InChIKey | RCHCFCDZENXCRI-JUVFNHDTSA-N |
| XLogP | 5.63 |
| TPSA | 210.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.65 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|