C43H34N10Na2O14S4 — CID 170840412
CID 170840412 (PubChem CID 170840412) has the molecular formula C43H34N10Na2O14S4 and a molecular weight of 1089.05 g/mol.
| Compound Name | CID 170840412 |
|---|---|
| PubChem CID | 170840412 |
| Molecular Formula | C43H34N10Na2O14S4 |
| Molecular Weight | 1089.05 g/mol |
| Exact Mass | 1088.09 |
| IUPAC Name | — |
| SMILES | CS(=O)(=O)c1ccc(O)c(/N=N/c2c(S(=O)(=O)O)cc3cc(Nc4nc(=Nc5ccccc5)nc(Nc5ccc6c(O)c(/N=N/c7cc(S(C)(=O)=O)ccc7O)c(S(=O)(=O)O)cc6c5)[nH]4)ccc3c2O)c1.[Na].[Na] |
| InChI | InChI=1S/C43H34N10O14S4.2Na/c1-68(58,59)27-10-14-33(54)31(20-27)50-52-37-35(70(62,63)64)18-22-16-25(8-12-29(22)39(37)56)45-42-47-41(44-24-6-4-3-5-7-24)48-43(49-42)46-26-9-13-30-23(17-26)19-36(71(65,66)67)38(40(30)57)53-51-32-21-28(69(2,60)61)11-15-34(32)55;;/h3-21,54-57H,1-2H3,(H,62,63,64)(H,65,66,67)(H3,44,45,46,47,48,49);;/b52-50+,53-51+;; |
| InChIKey | YEWFGLHFRPQTIH-KSNCYXERSA-N |
| XLogP | 7.02 |
| TPSA | 385.37 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 73 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1089.05 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|