C29H19ClN8O10S2 — CID 170840624
7-[(4-chloro-6-phenylimino-1H-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-[(2-hydroxy-6-nitro-4-sulfonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 170840624) has the molecular formula C29H19ClN8O10S2 and a molecular weight of 739.10 g/mol. Its IUPAC name is 7-[(4-chloro-6-phenylimino-1H-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-[(2-hydroxy-6-nitro-4-sulfonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 7-[(4-chloro-6-phenylimino-1H-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-[(2-hydroxy-6-nitro-4-sulfonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 170840624 |
| Molecular Formula | C29H19ClN8O10S2 |
| Molecular Weight | 739.10 g/mol |
| Exact Mass | 738.04 |
| IUPAC Name | 7-[(4-chloro-6-phenylimino-1H-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-[(2-hydroxy-6-nitro-4-sulfonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | O=[N+]([O-])c1ccc2c(/N=N/c3c(S(=O)(=O)O)cc4cc(Nc5nc(Cl)n/c(=N\c6ccccc6)[nH]5)ccc4c3O)c(O)cc(S(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C29H19ClN8O10S2/c30-27-33-28(31-15-4-2-1-3-5-15)35-29(34-27)32-16-6-8-18-14(10-16)11-23(50(46,47)48)25(26(18)40)37-36-24-19-9-7-17(38(41)42)12-20(19)22(13-21(24)39)49(43,44)45/h1-13,39-40H,(H,43,44,45)(H,46,47,48)(H2,31,32,33,34,35)/b37-36+ |
| InChIKey | GALGIDKQNRVNLR-BSRQYYOTSA-N |
| XLogP | 5.97 |
| TPSA | 283.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.10 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|