C14H14N3O5S- — CID 163585792
2-[[4-[[hydroxy(oxido)amino]methyl]phenyl]diazenyl]-4-methylsulfonylphenol (PubChem CID 163585792) has the molecular formula C14H14N3O5S- and a molecular weight of 336.35 g/mol. Its IUPAC name is 2-[[4-[[hydroxy(oxido)amino]methyl]phenyl]diazenyl]-4-methylsulfonylphenol.
| Compound Name | 2-[[4-[[hydroxy(oxido)amino]methyl]phenyl]diazenyl]-4-methylsulfonylphenol |
|---|---|
| PubChem CID | 163585792 |
| Molecular Formula | C14H14N3O5S- |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-[[4-[[hydroxy(oxido)amino]methyl]phenyl]diazenyl]-4-methylsulfonylphenol |
| SMILES | CS(=O)(=O)c1ccc(O)c(/N=N/c2ccc(CN([O-])O)cc2)c1 |
| InChI | InChI=1S/C14H14N3O5S/c1-23(21,22)12-6-7-14(18)13(8-12)16-15-11-4-2-10(3-5-11)9-17(19)20/h2-8,18-19H,9H2,1H3/q-1/b16-15+ |
| InChIKey | IBVSAQJYSUMERQ-FOCLMDBBSA-N |
| XLogP | 2.90 |
| TPSA | 125.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|