C22H21N3O3S — CID 4570942
2-[[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]diazenyl]-4-ethylphenol (PubChem CID 4570942) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is 2-[[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]diazenyl]-4-ethylphenol.
| Compound Name | 2-[[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]diazenyl]-4-ethylphenol |
|---|---|
| PubChem CID | 4570942 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 2-[[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]diazenyl]-4-ethylphenol |
| SMILES | CCc1ccc(O)c(/N=N/c2ccc(S(=O)(=O)N3CCc4ccccc43)cc2)c1 |
| InChI | InChI=1S/C22H21N3O3S/c1-2-16-7-12-22(26)20(15-16)24-23-18-8-10-19(11-9-18)29(27,28)25-14-13-17-5-3-4-6-21(17)25/h3-12,15,26H,2,13-14H2,1H3/b24-23+ |
| InChIKey | VILBASSFZPQAKS-WCWDXBQESA-N |
| XLogP | 5.12 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|