C33H23N6O8S2- — CID 154602841
1-[4-[[6-carboxy-3-[[4-[(4-ethenylsulfonylphenyl)diazenyl]naphthalen-1-yl]diazenyl]-2,4-dihydroxyphenyl]diazenyl]phenyl]ethenesulfinate (PubChem CID 154602841) has the molecular formula C33H23N6O8S2- and a molecular weight of 695.72 g/mol. Its IUPAC name is 1-[4-[[6-carboxy-3-[[4-[(4-ethenylsulfonylphenyl)diazenyl]naphthalen-1-yl]diazenyl]-2,4-dihydroxyphenyl]diazenyl]phenyl]ethenesulfinate.
| Compound Name | 1-[4-[[6-carboxy-3-[[4-[(4-ethenylsulfonylphenyl)diazenyl]naphthalen-1-yl]diazenyl]-2,4-dihydroxyphenyl]diazenyl]phenyl]ethenesulfinate |
|---|---|
| PubChem CID | 154602841 |
| Molecular Formula | C33H23N6O8S2- |
| Molecular Weight | 695.72 g/mol |
| Exact Mass | 695.10 |
| IUPAC Name | 1-[4-[[6-carboxy-3-[[4-[(4-ethenylsulfonylphenyl)diazenyl]naphthalen-1-yl]diazenyl]-2,4-dihydroxyphenyl]diazenyl]phenyl]ethenesulfinate |
| SMILES | C=CS(=O)(=O)c1ccc(/N=N/c2ccc(/N=N/c3c(O)cc(C(=O)O)c(/N=N/c4ccc(C(=C)S(=O)[O-])cc4)c3O)c3ccccc23)cc1 |
| InChI | InChI=1S/C33H24N6O8S2/c1-3-49(46,47)23-14-12-22(13-15-23)34-36-27-16-17-28(25-7-5-4-6-24(25)27)37-39-31-29(40)18-26(33(42)43)30(32(31)41)38-35-21-10-8-20(9-11-21)19(2)48(44)45/h3-18,40-41H,1-2H2,(H,42,43)(H,44,45)/p-1/b36-34+,38-35+,39-37+ |
| InChIKey | LFVFFRDFEUNWLH-BAAMGICKSA-M |
| XLogP | 8.96 |
| TPSA | 226.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.72 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|