C19H16ClNO7S2 — CID 18431383
6-[[3-(2-chloroethylsulfonyl)benzoyl]amino]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 18431383) has the molecular formula C19H16ClNO7S2 and a molecular weight of 469.92 g/mol. Its IUPAC name is 6-[[3-(2-chloroethylsulfonyl)benzoyl]amino]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 6-[[3-(2-chloroethylsulfonyl)benzoyl]amino]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 18431383 |
| Molecular Formula | C19H16ClNO7S2 |
| Molecular Weight | 469.92 g/mol |
| Exact Mass | 469.01 |
| IUPAC Name | 6-[[3-(2-chloroethylsulfonyl)benzoyl]amino]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | O=C(Nc1ccc2cc(S(=O)(=O)O)cc(O)c2c1)c1cccc(S(=O)(=O)CCCl)c1 |
| InChI | InChI=1S/C19H16ClNO7S2/c20-6-7-29(24,25)15-3-1-2-13(9-15)19(23)21-14-5-4-12-8-16(30(26,27)28)11-18(22)17(12)10-14/h1-5,8-11,22H,6-7H2,(H,21,23)(H,26,27,28) |
| InChIKey | GHBTWKOFCFLALS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.92 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|