C14H16ClNO6S2 — CID 22155713
6-[2-chloroethylsulfonyl(ethyl)amino]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 22155713) has the molecular formula C14H16ClNO6S2 and a molecular weight of 393.87 g/mol. Its IUPAC name is 6-[2-chloroethylsulfonyl(ethyl)amino]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 6-[2-chloroethylsulfonyl(ethyl)amino]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 22155713 |
| Molecular Formula | C14H16ClNO6S2 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 6-[2-chloroethylsulfonyl(ethyl)amino]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | CCN(c1ccc2cc(S(=O)(=O)O)cc(O)c2c1)S(=O)(=O)CCCl |
| InChI | InChI=1S/C14H16ClNO6S2/c1-2-16(23(18,19)6-5-15)11-4-3-10-7-12(24(20,21)22)9-14(17)13(10)8-11/h3-4,7-9,17H,2,5-6H2,1H3,(H,20,21,22) |
| InChIKey | HCPJDCDTVFQBNK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|