C14H15N3O7S2 — CID 21285176
2-[5-amino-2-(4-amino-3-sulfoanilino)phenyl]sulfonylacetic acid (PubChem CID 21285176) has the molecular formula C14H15N3O7S2 and a molecular weight of 401.42 g/mol. Its IUPAC name is 2-[5-amino-2-(4-amino-3-sulfoanilino)phenyl]sulfonylacetic acid.
| Compound Name | 2-[5-amino-2-(4-amino-3-sulfoanilino)phenyl]sulfonylacetic acid |
|---|---|
| PubChem CID | 21285176 |
| Molecular Formula | C14H15N3O7S2 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 2-[5-amino-2-(4-amino-3-sulfoanilino)phenyl]sulfonylacetic acid |
| SMILES | Nc1ccc(Nc2ccc(N)c(S(=O)(=O)O)c2)c(S(=O)(=O)CC(=O)O)c1 |
| InChI | InChI=1S/C14H15N3O7S2/c15-8-1-4-11(13(5-8)25(20,21)7-14(18)19)17-9-2-3-10(16)12(6-9)26(22,23)24/h1-6,17H,7,15-16H2,(H,18,19)(H,22,23,24) |
| InChIKey | XLUWDESLCYEADI-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 189.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|