C9H9N5O3S — CID 88784839
2-amino-5-(triazin-4-ylamino)benzenesulfonic acid (PubChem CID 88784839) has the molecular formula C9H9N5O3S and a molecular weight of 267.27 g/mol. Its IUPAC name is 2-amino-5-(triazin-4-ylamino)benzenesulfonic acid.
| Compound Name | 2-amino-5-(triazin-4-ylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 88784839 |
| Molecular Formula | C9H9N5O3S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 2-amino-5-(triazin-4-ylamino)benzenesulfonic acid |
| SMILES | Nc1ccc(Nc2ccnnn2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C9H9N5O3S/c10-7-2-1-6(5-8(7)18(15,16)17)12-9-3-4-11-14-13-9/h1-5H,10H2,(H,11,12,13)(H,15,16,17) |
| InChIKey | VWPUCKPXWQLXJC-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 131.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|