C16H20N2O3S — CID 70408457
2-[5-amino-2-(1-phenylethylamino)phenyl]sulfonylethanol (PubChem CID 70408457) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 2-[5-amino-2-(1-phenylethylamino)phenyl]sulfonylethanol.
| Compound Name | 2-[5-amino-2-(1-phenylethylamino)phenyl]sulfonylethanol |
|---|---|
| PubChem CID | 70408457 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-[5-amino-2-(1-phenylethylamino)phenyl]sulfonylethanol |
| SMILES | CC(Nc1ccc(N)cc1S(=O)(=O)CCO)c1ccccc1 |
| InChI | InChI=1S/C16H20N2O3S/c1-12(13-5-3-2-4-6-13)18-15-8-7-14(17)11-16(15)22(20,21)10-9-19/h2-8,11-12,18-19H,9-10,17H2,1H3 |
| InChIKey | FQMFECZOCKUSPM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|