C15H23N3O6S — CID 54373174
4-[1-[4-amino-2-(2-hydroxyethylsulfonyl)anilino]propan-2-ylamino]-4-oxobutanoic acid (PubChem CID 54373174) has the molecular formula C15H23N3O6S and a molecular weight of 373.43 g/mol. Its IUPAC name is 4-[1-[4-amino-2-(2-hydroxyethylsulfonyl)anilino]propan-2-ylamino]-4-oxobutanoic acid.
| Compound Name | 4-[1-[4-amino-2-(2-hydroxyethylsulfonyl)anilino]propan-2-ylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54373174 |
| Molecular Formula | C15H23N3O6S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 4-[1-[4-amino-2-(2-hydroxyethylsulfonyl)anilino]propan-2-ylamino]-4-oxobutanoic acid |
| SMILES | CC(CNc1ccc(N)cc1S(=O)(=O)CCO)NC(=O)CCC(=O)O |
| InChI | InChI=1S/C15H23N3O6S/c1-10(18-14(20)4-5-15(21)22)9-17-12-3-2-11(16)8-13(12)25(23,24)7-6-19/h2-3,8,10,17,19H,4-7,9,16H2,1H3,(H,18,20)(H,21,22) |
| InChIKey | UUQQSNHVXBVDOP-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|