C18H15CuN3O11S3 — CID 170845023
copper 6-amino-2-[[2-oxido-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-3-sulfonaphthalen-1-olate (PubChem CID 170845023) has the molecular formula C18H15CuN3O11S3 and a molecular weight of 609.08 g/mol. Its IUPAC name is copper 6-amino-2-[[2-oxido-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-3-sulfonaphthalen-1-olate.
| Compound Name | copper 6-amino-2-[[2-oxido-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-3-sulfonaphthalen-1-olate |
|---|---|
| PubChem CID | 170845023 |
| Molecular Formula | C18H15CuN3O11S3 |
| Molecular Weight | 609.08 g/mol |
| Exact Mass | 607.92 |
| IUPAC Name | copper 6-amino-2-[[2-oxido-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-3-sulfonaphthalen-1-olate |
| SMILES | Nc1ccc2c([O-])c(/N=N/c3ccc(S(=O)(=O)CCOS(=O)(=O)O)cc3[O-])c(S(=O)(=O)O)cc2c1.[Cu+2] |
| InChI | InChI=1S/C18H17N3O11S3.Cu/c19-11-1-3-13-10(7-11)8-16(34(26,27)28)17(18(13)23)21-20-14-4-2-12(9-15(14)22)33(24,25)6-5-32-35(29,30)31;/h1-4,7-9,22-23H,5-6,19H2,(H,26,27,28)(H,29,30,31);/q;+2/p-2/b21-20+; |
| InChIKey | VYSJDRDKBLQZQO-ANVLNOONSA-L |
| XLogP | 0.82 |
| TPSA | 248.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.08 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|