C22H10F6I2O6S2 — CID 130383942
[5-iodo-1-[5-iodo-2-(trifluoromethylsulfonyloxy)naphthalen-1-yl]naphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 130383942) has the molecular formula C22H10F6I2O6S2 and a molecular weight of 802.25 g/mol. Its IUPAC name is [5-iodo-1-[5-iodo-2-(trifluoromethylsulfonyloxy)naphthalen-1-yl]naphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [5-iodo-1-[5-iodo-2-(trifluoromethylsulfonyloxy)naphthalen-1-yl]naphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 130383942 |
| Molecular Formula | C22H10F6I2O6S2 |
| Molecular Weight | 802.25 g/mol |
| Exact Mass | 801.79 |
| IUPAC Name | [5-iodo-1-[5-iodo-2-(trifluoromethylsulfonyloxy)naphthalen-1-yl]naphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c(I)cccc2c1-c1c(OS(=O)(=O)C(F)(F)F)ccc2c(I)cccc12)C(F)(F)F |
| InChI | InChI=1S/C22H10F6I2O6S2/c23-21(24,25)37(31,32)35-17-9-7-11-13(3-1-5-15(11)29)19(17)20-14-4-2-6-16(30)12(14)8-10-18(20)36-38(33,34)22(26,27)28/h1-10H |
| InChIKey | SPAXRJSXGWSQEE-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.25 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|